CAS 204274-74-8 appears in our catalog under these names: RS 45041–190 hydrochloride, RS 45041-190 hydrochloride, RS 45041-190 (hydrochloride). Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 50mg, 100mg, Get quote.
4-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole;hydrochloride (CAS 204274-74-8) is a chemical compound with the molecular formula C11H13Cl2N3 and a molecular weight of 258.14 g/mol. IUPAC name: 4-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole;hydrochloride. InChIKey: WRYJNVYEPVATQV-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N3 |
|---|---|
| Molecular weight | 258.14 g/mol |
| IUPAC name | 4-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole;hydrochloride |
| InChIKey | WRYJNVYEPVATQV-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)N2CC3=C(C2)C(=CC=C3)Cl.Cl |
Computed by PubChem (NCBI)