CAS 1909337-69-4 appears in our catalog under these names: N1-(Pyridin-4-yl)benzene-1,4-diamine dihydrochloride, N1-(Pyridin-4-yl)benzene-1,4-diamine dihydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
4-N-pyridin-4-ylbenzene-1,4-diamine;dihydrochloride (CAS 1909337-69-4) is a chemical compound with the molecular formula C11H13Cl2N3 and a molecular weight of 258.14 g/mol. IUPAC name: 4-N-pyridin-4-ylbenzene-1,4-diamine;dihydrochloride. InChIKey: QPPYJDAHAQQLOS-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N3 |
|---|---|
| Molecular weight | 258.14 g/mol |
| IUPAC name | 4-N-pyridin-4-ylbenzene-1,4-diamine;dihydrochloride |
| InChIKey | QPPYJDAHAQQLOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NC2=CC=NC=C2.Cl.Cl |
Computed by PubChem (NCBI)