Products 14148-99-3
CAS 14148-99-3 is the registry number for Lefetamine Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg.
(1R)-N,N-dimethyl-1,2-diphenylethanamine;hydrochloride (CAS 14148-99-3) is a chemical compound with the molecular formula C16H20ClN and a molecular weight of 261.79 g/mol. IUPAC name: (1R)-N,N-dimethyl-1,2-diphenylethanamine;hydrochloride. InChIKey: VKIHKZMKDNVEIK-PKLMIRHRSA-N.
| Molecular formula | C16H20ClN |
|---|---|
| Molecular weight | 261.79 g/mol |
| IUPAC name | (1R)-N,N-dimethyl-1,2-diphenylethanamine;hydrochloride |
| InChIKey | VKIHKZMKDNVEIK-PKLMIRHRSA-N |
| SMILES | CN(C)[C@H](CC1=CC=CC=C1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)
Synonyms:
Lefetamine hydrochloride, Lefetamine HCl, SPA (analgesic), (-)-N,N-Dimethyl-1,2-diphenylethylamine hydrochloride, Lefetamine hydrochloride [JAN], DEA No. 1635, l-1,2-Diphenyl-1-dimethylaminoethane hydrochloride, Benzeneethanamine, N,N-dimethyl-alpha-phenyl-, hydrochloride, (R)-,, LEFETAMINE HYDROCHLORIDE [MI], LEFETAMINE HYDROCHLORIDE [MART.]