Products 1171489-65-8

CAS 1171489-65-8 is the registry number for (3,5-Dimethyl-1h-pyrazol-1-yl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(3,5-dimethylpyrazol-1-yl)acetic acid;hydrochloride (CAS 1171489-65-8) is a chemical compound with the molecular formula C7H11ClN2O2 and a molecular weight of 190.63 g/mol. IUPAC name: 2-(3,5-dimethylpyrazol-1-yl)acetic acid;hydrochloride. InChIKey: MFUUWMMNHDRDJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11ClN2O2
Molecular weight190.63 g/mol
IUPAC name2-(3,5-dimethylpyrazol-1-yl)acetic acid;hydrochloride
InChIKeyMFUUWMMNHDRDJQ-UHFFFAOYSA-N
SMILESCC1=CC(=NN1CC(=O)O)C.Cl

Computed by PubChem (NCBI)