Products 80789-72-6

CAS 80789-72-6 appears in our catalog under these names: 3-Amino-2,6-dimethoxypyridine monohydrochloride, 97%, 2,6-Dimethoxypyridin-3-amine hydrochloride 97%, 3-Amino-2,6-dimethoxypyridine monohydrochloride, 97%, 97%, 2,6-Dimethoxypyridin-3-amine hydrochloride, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2,6-dimethoxypyridin-3-amine;hydrochloride (CAS 80789-72-6) is a chemical compound with the molecular formula C7H11ClN2O2 and a molecular weight of 190.63 g/mol. IUPAC name: 2,6-dimethoxypyridin-3-amine;hydrochloride. InChIKey: FITCPYYVAJWASG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11ClN2O2
Molecular weight190.63 g/mol
IUPAC name2,6-dimethoxypyridin-3-amine;hydrochloride
InChIKeyFITCPYYVAJWASG-UHFFFAOYSA-N
SMILESCOC1=NC(=C(C=C1)N)OC.Cl

Computed by PubChem (NCBI)