CAS 2253639-14-2 appears in our catalog under these names: 2-(1,3-dimethyl-1h-pyrazol-5-yl)acetic acid hydrochloride, 95%, 2-(1,3-Dimethyl-1H-pyrazol-5-yl)acetic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g.
2-(2,5-dimethylpyrazol-3-yl)acetic acid;hydrochloride (CAS 2253639-14-2) is a chemical compound with the molecular formula C7H11ClN2O2 and a molecular weight of 190.63 g/mol. IUPAC name: 2-(2,5-dimethylpyrazol-3-yl)acetic acid;hydrochloride. InChIKey: BIWOUERCKDGBHI-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2 |
|---|---|
| Molecular weight | 190.63 g/mol |
| IUPAC name | 2-(2,5-dimethylpyrazol-3-yl)acetic acid;hydrochloride |
| InChIKey | BIWOUERCKDGBHI-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)CC(=O)O)C.Cl |
Computed by PubChem (NCBI)