Products 1171493-17-6

CAS 1171493-17-6 is the registry number for Ethyl 2-methylpiperidine-2-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-methylpiperidine-2-carboxylate;hydrochloride (CAS 1171493-17-6) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: ethyl 2-methylpiperidine-2-carboxylate;hydrochloride. InChIKey: QYZORNGMTNOLOW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO2
Molecular weight207.70 g/mol
IUPAC nameethyl 2-methylpiperidine-2-carboxylate;hydrochloride
InChIKeyQYZORNGMTNOLOW-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCCCN1)C.Cl

Computed by PubChem (NCBI)