Products 1171876-52-0
CAS 1171876-52-0 appears in our catalog under these names: Indoline-5-carboxylic acid hydrochloride, 95%, Indoline-5-carboxylic acid hydrochloride, 95+%, 2,3-Dihydro-1H-indole-5-carboxylic acid hydrochloride, 95+%, 95+%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
2,3-dihydro-1H-indole-5-carboxylic acid;hydrochloride (CAS 1171876-52-0) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 2,3-dihydro-1H-indole-5-carboxylic acid;hydrochloride. InChIKey: WTBSYTMVLQRZGK-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 2,3-dihydro-1H-indole-5-carboxylic acid;hydrochloride |
| InChIKey | WTBSYTMVLQRZGK-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)