Products 1171892-77-5
CAS 1171892-77-5 is the registry number for 5-(1-Methyl-4-pyrazolyl)pyridine-3-boronic Acid Pinacol Ester, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1171892-77-5) is a chemical compound with the molecular formula C15H20BN3O2 and a molecular weight of 285.15 g/mol. IUPAC name: 3-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: HFZIZUJPOHOYGZ-UHFFFAOYSA-N.
| Molecular formula | C15H20BN3O2 |
|---|---|
| Molecular weight | 285.15 g/mol |
| IUPAC name | 3-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | HFZIZUJPOHOYGZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C3=CN(N=C3)C |
Computed by PubChem (NCBI)