CAS 1402240-29-2 is the registry number for 1-(2-Methyl-4-pyridyl)-1H-pyrazole-4-boronic Acid Pinacol Ester, >97%, >97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pyridine (CAS 1402240-29-2) is a chemical compound with the molecular formula C15H20BN3O2 and a molecular weight of 285.15 g/mol. IUPAC name: 2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pyridine. InChIKey: OEGXHMMYYIBCHI-UHFFFAOYSA-N.
| Molecular formula | C15H20BN3O2 |
|---|---|
| Molecular weight | 285.15 g/mol |
| IUPAC name | 2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pyridine |
| InChIKey | OEGXHMMYYIBCHI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3=CC(=NC=C3)C |
Computed by PubChem (NCBI)