CAS 1171919-90-6 is the registry number for 5-Bromo-n,3-dimethoxy-n-methylpicolinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-bromo-N,3-dimethoxy-N-methylpyridine-2-carboxamide (CAS 1171919-90-6) is a chemical compound with the molecular formula C9H11BrN2O3 and a molecular weight of 275.10 g/mol. IUPAC name: 5-bromo-N,3-dimethoxy-N-methylpyridine-2-carboxamide. InChIKey: OTKONIFRHMHLGF-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O3 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 5-bromo-N,3-dimethoxy-N-methylpyridine-2-carboxamide |
| InChIKey | OTKONIFRHMHLGF-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=C(C=C(C=N1)Br)OC)OC |
Computed by PubChem (NCBI)