CAS 2758166-22-0 is the registry number for Ethyl (R)-6-bromo-2-methyl-2,3-dihydropyrazolo[5,1-b]oxazole-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2R)-6-bromo-2-methyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-7-carboxylate (CAS 2758166-22-0) is a chemical compound with the molecular formula C9H11BrN2O3 and a molecular weight of 275.10 g/mol. IUPAC name: ethyl (2R)-6-bromo-2-methyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-7-carboxylate. InChIKey: GODRBRXICJDYSC-RXMQYKEDSA-N.
| Molecular formula | C9H11BrN2O3 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | ethyl (2R)-6-bromo-2-methyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-7-carboxylate |
| InChIKey | GODRBRXICJDYSC-RXMQYKEDSA-N |
| SMILES | CCOC(=O)C1=C2N(C[C@H](O2)C)N=C1Br |
Computed by PubChem (NCBI)