Products 2757303-70-9

CAS 2757303-70-9 is the registry number for 2-(4-Bromo-3-isopropyl-6-oxopyridazin-1(6H)-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-bromo-6-oxo-3-propan-2-ylpyridazin-1-yl)acetic acid (CAS 2757303-70-9) is a chemical compound with the molecular formula C9H11BrN2O3 and a molecular weight of 275.10 g/mol. IUPAC name: 2-(4-bromo-6-oxo-3-propan-2-ylpyridazin-1-yl)acetic acid. InChIKey: UGZZHIUIANRELO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BrN2O3
Molecular weight275.10 g/mol
IUPAC name2-(4-bromo-6-oxo-3-propan-2-ylpyridazin-1-yl)acetic acid
InChIKeyUGZZHIUIANRELO-UHFFFAOYSA-N
SMILESCC(C)C1=NN(C(=O)C=C1Br)CC(=O)O

Computed by PubChem (NCBI)