CAS 1171920-66-3 is the registry number for 3-Methyl-6-(trimethylsilyl)-3h-imidazo[4,5-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Trimethyl-(3-methylimidazo[4,5-b]pyridin-6-yl)silane (CAS 1171920-66-3) is a chemical compound with the molecular formula C10H15N3Si and a molecular weight of 205.33 g/mol. IUPAC name: trimethyl-(3-methylimidazo[4,5-b]pyridin-6-yl)silane. InChIKey: WDQCEVJQYHRSSP-UHFFFAOYSA-N.
| Molecular formula | C10H15N3Si |
|---|---|
| Molecular weight | 205.33 g/mol |
| IUPAC name | trimethyl-(3-methylimidazo[4,5-b]pyridin-6-yl)silane |
| InChIKey | WDQCEVJQYHRSSP-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1N=CC(=C2)[Si](C)(C)C |
Computed by PubChem (NCBI)