CAS 936342-41-5 is the registry number for 3-Trimethylsilanylethynyl-pyridine-2,6-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(2-trimethylsilylethynyl)pyridine-2,6-diamine (CAS 936342-41-5) is a chemical compound with the molecular formula C10H15N3Si and a molecular weight of 205.33 g/mol. IUPAC name: 3-(2-trimethylsilylethynyl)pyridine-2,6-diamine. InChIKey: ULLCGVNMSDQYJJ-UHFFFAOYSA-N.
| Molecular formula | C10H15N3Si |
|---|---|
| Molecular weight | 205.33 g/mol |
| IUPAC name | 3-(2-trimethylsilylethynyl)pyridine-2,6-diamine |
| InChIKey | ULLCGVNMSDQYJJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=C(N=C(C=C1)N)N |
Computed by PubChem (NCBI)