CAS 157984-24-2 appears in our catalog under these names: 2-((Trimethylsilyl)methyl)-2h-benzo[d][1,2,3]triazole, 95%, 2-((Trimethylsilyl)methyl)-2H-benzo(d)(1,2,3)triazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Benzotriazol-2-ylmethyl(trimethyl)silane (CAS 157984-24-2) is a chemical compound with the molecular formula C10H15N3Si and a molecular weight of 205.33 g/mol. IUPAC name: benzotriazol-2-ylmethyl(trimethyl)silane. InChIKey: NCKDKNHHOIHWQS-UHFFFAOYSA-N.
| Molecular formula | C10H15N3Si |
|---|---|
| Molecular weight | 205.33 g/mol |
| IUPAC name | benzotriazol-2-ylmethyl(trimethyl)silane |
| InChIKey | NCKDKNHHOIHWQS-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CN1N=C2C=CC=CC2=N1 |
Computed by PubChem (NCBI)