CAS 117211-21-9 is the registry number for 2-Amino-5-chloro-n-(4-methylphenyl)benzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[(3-chlorophenyl)-phenylmethyl]urea (CAS 117211-21-9) is a chemical compound with the molecular formula C14H13ClN2O and a molecular weight of 260.72 g/mol. IUPAC name: [(3-chlorophenyl)-phenylmethyl]urea. InChIKey: VQPUSIQKYOCUMK-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O |
|---|---|
| Molecular weight | 260.72 g/mol |
| IUPAC name | [(3-chlorophenyl)-phenylmethyl]urea |
| InChIKey | VQPUSIQKYOCUMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=CC=C2)Cl)NC(=O)N |
Computed by PubChem (NCBI)