CAS 1251924-79-4 appears in our catalog under these names: 3-(4-Aminophenoxymethyl)benzonitrile hydrochloride, 3-(4-Aminophenoxymethyl)benzonitrile hydrochloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 1g, 10g, 250mg, 100mg.
3-[(4-aminophenoxy)methyl]benzonitrile;hydrochloride (CAS 1251924-79-4) is a chemical compound with the molecular formula C14H13ClN2O and a molecular weight of 260.72 g/mol. IUPAC name: 3-[(4-aminophenoxy)methyl]benzonitrile;hydrochloride. InChIKey: PFODVHXLUCJTFY-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O |
|---|---|
| Molecular weight | 260.72 g/mol |
| IUPAC name | 3-[(4-aminophenoxy)methyl]benzonitrile;hydrochloride |
| InChIKey | PFODVHXLUCJTFY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C#N)COC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)