Products 1373232-61-1
CAS 1373232-61-1 appears in our catalog under these names: 1H-1,3-Benzodiazol-5-yl(phenyl)methanol hydrochloride, 98%, 1H-1,3-Benzodiazol-5-yl(phenyl)methanol, HCl, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3H-benzimidazol-5-yl(phenyl)methanol;hydrochloride (CAS 1373232-61-1) is a chemical compound with the molecular formula C14H13ClN2O and a molecular weight of 260.72 g/mol. IUPAC name: 3H-benzimidazol-5-yl(phenyl)methanol;hydrochloride. InChIKey: NZVTYJWIYZFKGZ-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O |
|---|---|
| Molecular weight | 260.72 g/mol |
| IUPAC name | 3H-benzimidazol-5-yl(phenyl)methanol;hydrochloride |
| InChIKey | NZVTYJWIYZFKGZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC3=C(C=C2)N=CN3)O.Cl |
Computed by PubChem (NCBI)