CAS 1172263-55-6 appears in our catalog under these names: 1-[4-(Methylsulfonyl)-2-nitrophenyl]piperazine hydrochloride, 95%, 1-(4-Methanesulfonyl-2-nitrophenyl)piperazine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g.
1-(4-methylsulfonyl-2-nitrophenyl)piperazine;hydrochloride (CAS 1172263-55-6) is a chemical compound with the molecular formula C11H16ClN3O4S and a molecular weight of 321.78 g/mol. IUPAC name: 1-(4-methylsulfonyl-2-nitrophenyl)piperazine;hydrochloride. InChIKey: UZFYPEJLGHSKBL-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O4S |
|---|---|
| Molecular weight | 321.78 g/mol |
| IUPAC name | 1-(4-methylsulfonyl-2-nitrophenyl)piperazine;hydrochloride |
| InChIKey | UZFYPEJLGHSKBL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)N2CCNCC2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)