CAS 1233958-29-6 is the registry number for 4-Nitro-N-(piperidin-4-yl)benzenesulfonamide hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
4-nitro-N-piperidin-4-ylbenzenesulfonamide;hydrochloride (CAS 1233958-29-6) is a chemical compound with the molecular formula C11H16ClN3O4S and a molecular weight of 321.78 g/mol. IUPAC name: 4-nitro-N-piperidin-4-ylbenzenesulfonamide;hydrochloride. InChIKey: NVDGYSCHKOLJRI-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O4S |
|---|---|
| Molecular weight | 321.78 g/mol |
| IUPAC name | 4-nitro-N-piperidin-4-ylbenzenesulfonamide;hydrochloride |
| InChIKey | NVDGYSCHKOLJRI-UHFFFAOYSA-N |
| SMILES | C1CNCCC1NS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)