Products 53803-81-9
CAS 53803-81-9 appears in our catalog under these names: 4-Chloro-n-[3-(dimethylamino)propyl]-3-nitrobenzenesulfonamide, 95%, 4-Chloro-N-(3-(dimethylamino)propyl)-3-nitrobenzene-1-sulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 0,5g.
4-chloro-N-[3-(dimethylamino)propyl]-3-nitrobenzenesulfonamide (CAS 53803-81-9) is a chemical compound with the molecular formula C11H16ClN3O4S and a molecular weight of 321.78 g/mol. IUPAC name: 4-chloro-N-[3-(dimethylamino)propyl]-3-nitrobenzenesulfonamide. InChIKey: AVYJCSLKKCJVJF-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O4S |
|---|---|
| Molecular weight | 321.78 g/mol |
| IUPAC name | 4-chloro-N-[3-(dimethylamino)propyl]-3-nitrobenzenesulfonamide |
| InChIKey | AVYJCSLKKCJVJF-UHFFFAOYSA-N |
| SMILES | CN(C)CCCNS(=O)(=O)C1=CC(=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)