Products 1172303-17-1
CAS 1172303-17-1 is the registry number for 3-Cyclopropyl-1-(2-fluorophenyl)-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-cyclopropyl-1-(2-fluorophenyl)pyrazol-5-amine (CAS 1172303-17-1) is a chemical compound with the molecular formula C12H12FN3 and a molecular weight of 217.24 g/mol. IUPAC name: 3-cyclopropyl-1-(2-fluorophenyl)pyrazol-5-amine. InChIKey: SWZIPGYJKCJYOZ-UHFFFAOYSA-N.
| Molecular formula | C12H12FN3 |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | 3-cyclopropyl-1-(2-fluorophenyl)pyrazol-5-amine |
| InChIKey | SWZIPGYJKCJYOZ-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN(C(=C2)N)C3=CC=CC=C3F |
Computed by PubChem (NCBI)