CAS 1383735-39-4 is the registry number for 1-(4-Fluorophenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine (CAS 1383735-39-4) is a chemical compound with the molecular formula C12H12FN3 and a molecular weight of 217.24 g/mol. IUPAC name: 1-(4-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine. InChIKey: PDWCTQILQWGJMN-UHFFFAOYSA-N.
| Molecular formula | C12H12FN3 |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridine |
| InChIKey | PDWCTQILQWGJMN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=NN2C3=CC=C(C=C3)F)NC1 |
Computed by PubChem (NCBI)