Products 1502594-68-4
CAS 1502594-68-4 appears in our catalog under these names: 1-(3-Fluorophenyl)-1h,4h,5h,6h,7h-pyrazolo[4,3-c]pyridine, 95%, 1-(3-Fluorophenyl)-4,5,6,7-tetrahydro-1H-pyrazolo(4,3-c)pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1-(3-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine (CAS 1502594-68-4) is a chemical compound with the molecular formula C12H12FN3 and a molecular weight of 217.24 g/mol. IUPAC name: 1-(3-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine. InChIKey: VAEHBVDXQNRGCZ-UHFFFAOYSA-N.
| Molecular formula | C12H12FN3 |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine |
| InChIKey | VAEHBVDXQNRGCZ-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1N(N=C2)C3=CC(=CC=C3)F |
Computed by PubChem (NCBI)