Products 1172625-85-2

CAS 1172625-85-2 is the registry number for 1,4-Diethyl-6-methoxy-1,2,3,4-tetrahydroquinoxaline, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 5g, 250mg.

Structural formula: {0} (CAS {1})

1,4-diethyl-6-methoxy-2,3-dihydroquinoxaline (CAS 1172625-85-2) is a chemical compound with the molecular formula C13H20N2O and a molecular weight of 220.31 g/mol. IUPAC name: 1,4-diethyl-6-methoxy-2,3-dihydroquinoxaline. InChIKey: PYXTXWOFTWDIJG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20N2O
Molecular weight220.31 g/mol
IUPAC name1,4-diethyl-6-methoxy-2,3-dihydroquinoxaline
InChIKeyPYXTXWOFTWDIJG-UHFFFAOYSA-N
SMILESCCN1CCN(C2=C1C=CC(=C2)OC)CC

Computed by PubChem (NCBI)