CAS 1172857-56-5 is the registry number for N-(2-Aminoethyl)-1,3-benzothiazol-2-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N'-(1,3-benzothiazol-2-yl)ethane-1,2-diamine;hydrochloride (CAS 1172857-56-5) is a chemical compound with the molecular formula C9H12ClN3S and a molecular weight of 229.73 g/mol. IUPAC name: N'-(1,3-benzothiazol-2-yl)ethane-1,2-diamine;hydrochloride. InChIKey: LWJCCEXDIUBSIJ-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3S |
|---|---|
| Molecular weight | 229.73 g/mol |
| IUPAC name | N'-(1,3-benzothiazol-2-yl)ethane-1,2-diamine;hydrochloride |
| InChIKey | LWJCCEXDIUBSIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NCCN.Cl |
Computed by PubChem (NCBI)