Products 1854951-22-6
CAS 1854951-22-6 is the registry number for 5-Chloro-N-(2,2-dimethylthietan-3-yl)pyrimidin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-N-(2,2-dimethylthietan-3-yl)pyrimidin-2-amine (CAS 1854951-22-6) is a chemical compound with the molecular formula C9H12ClN3S and a molecular weight of 229.73 g/mol. IUPAC name: 5-chloro-N-(2,2-dimethylthietan-3-yl)pyrimidin-2-amine. InChIKey: UMBXCNFTSVWZPG-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3S |
|---|---|
| Molecular weight | 229.73 g/mol |
| IUPAC name | 5-chloro-N-(2,2-dimethylthietan-3-yl)pyrimidin-2-amine |
| InChIKey | UMBXCNFTSVWZPG-UHFFFAOYSA-N |
| SMILES | CC1(C(CS1)NC2=NC=C(C=N2)Cl)C |
Computed by PubChem (NCBI)