Products 1866103-49-2
CAS 1866103-49-2 is the registry number for 2-Chloro-N-(2,2-dimethylthietan-3-yl)pyrimidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N-(2,2-dimethylthietan-3-yl)pyrimidin-4-amine (CAS 1866103-49-2) is a chemical compound with the molecular formula C9H12ClN3S and a molecular weight of 229.73 g/mol. IUPAC name: 2-chloro-N-(2,2-dimethylthietan-3-yl)pyrimidin-4-amine. InChIKey: JOBZBTXVYGHOFH-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3S |
|---|---|
| Molecular weight | 229.73 g/mol |
| IUPAC name | 2-chloro-N-(2,2-dimethylthietan-3-yl)pyrimidin-4-amine |
| InChIKey | JOBZBTXVYGHOFH-UHFFFAOYSA-N |
| SMILES | CC1(C(CS1)NC2=NC(=NC=C2)Cl)C |
Computed by PubChem (NCBI)