CAS 1172880-63-5 appears in our catalog under these names: 3-(1-Naphthylmethyl)-1,3-thiazol-2(3h)-imine hydrochloride, 95%, 3-((Naphthalen-1-yl)methyl)-2,3-dihydro-1,3-thiazol-2-imine hydrochloride, 95%, 3-(Naphthalen-1-ylmethyl)-2,3-dihydro-1,3-thiazol-2-imine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-(naphthalen-1-ylmethyl)-1,3-thiazol-2-imine;hydrochloride (CAS 1172880-63-5) is a chemical compound with the molecular formula C14H13ClN2S and a molecular weight of 276.8 g/mol. IUPAC name: 3-(naphthalen-1-ylmethyl)-1,3-thiazol-2-imine;hydrochloride. InChIKey: WEXDAFJGXFYWHA-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2S |
|---|---|
| Molecular weight | 276.8 g/mol |
| IUPAC name | 3-(naphthalen-1-ylmethyl)-1,3-thiazol-2-imine;hydrochloride |
| InChIKey | WEXDAFJGXFYWHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CN3C=CSC3=N.Cl |
Computed by PubChem (NCBI)