CAS 1215553-99-3 is the registry number for 4-(1,3-Benzothiazol-2-yl)-2-methylaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-(1,3-benzothiazol-2-yl)-2-methylaniline;hydrochloride (CAS 1215553-99-3) is a chemical compound with the molecular formula C14H13ClN2S and a molecular weight of 276.8 g/mol. IUPAC name: 4-(1,3-benzothiazol-2-yl)-2-methylaniline;hydrochloride. InChIKey: SNIFCEOSVDHSEX-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2S |
|---|---|
| Molecular weight | 276.8 g/mol |
| IUPAC name | 4-(1,3-benzothiazol-2-yl)-2-methylaniline;hydrochloride |
| InChIKey | SNIFCEOSVDHSEX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=NC3=CC=CC=C3S2)N.Cl |
Computed by PubChem (NCBI)