Products 57294-96-9
CAS 57294-96-9 is the registry number for 1-(3-chlorobenzyl)-3-phenylthiourea, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
1-[(3-chlorophenyl)methyl]-3-phenylthiourea (CAS 57294-96-9) is a chemical compound with the molecular formula C14H13ClN2S and a molecular weight of 276.8 g/mol. IUPAC name: 1-[(3-chlorophenyl)methyl]-3-phenylthiourea. InChIKey: CYGSXYUOPPKHAE-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2S |
|---|---|
| Molecular weight | 276.8 g/mol |
| IUPAC name | 1-[(3-chlorophenyl)methyl]-3-phenylthiourea |
| InChIKey | CYGSXYUOPPKHAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=S)NCC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)