Products 1173003-54-7
CAS 1173003-54-7 is the registry number for 1-(Tetrahydro-2H-pyran-2-yl)-1H-indazole-5-carbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(oxan-2-yl)indazole-5-carbonitrile (CAS 1173003-54-7) is a chemical compound with the molecular formula C13H13N3O and a molecular weight of 227.26 g/mol. IUPAC name: 1-(oxan-2-yl)indazole-5-carbonitrile. InChIKey: AGMZLYNPRZVJPW-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 1-(oxan-2-yl)indazole-5-carbonitrile |
| InChIKey | AGMZLYNPRZVJPW-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C3=C(C=C(C=C3)C#N)C=N2 |
Computed by PubChem (NCBI)