CAS 1173019-44-7 appears in our catalog under these names: Oxibendazole-d7, OXIBENDAZOLE-D7 VETRANAL., D7-Oxibendazole, Concentration: 100 µg/ml Solvent: Methanol, D7-Oxibendazole. Offered by: Chemat Brand, TRC, Sigma-Aldrich, HPC Standards. Available pack sizes: on request, 50mg, 10MG, 1x1ml, 1x10mg.
Methyl N-[6-(1,1,2,2,3,3,3-heptadeuteriopropoxy)-1H-benzimidazol-2-yl]carbamate (CAS 1173019-44-7) is a chemical compound with the molecular formula C12H15N3O3 and a molecular weight of 256.31 g/mol. IUPAC name: methyl N-[6-(1,1,2,2,3,3,3-heptadeuteriopropoxy)-1H-benzimidazol-2-yl]carbamate. InChIKey: RAOCRURYZCVHMG-JOMZKNQJSA-N.
| Molecular formula | C12H15N3O3 |
|---|---|
| Molecular weight | 256.31 g/mol |
| IUPAC name | methyl N-[6-(1,1,2,2,3,3,3-heptadeuteriopropoxy)-1H-benzimidazol-2-yl]carbamate |
| InChIKey | RAOCRURYZCVHMG-JOMZKNQJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])OC1=CC2=C(C=C1)N=C(N2)NC(=O)OC |
Computed by PubChem (NCBI)