CAS 1173019-45-8 appears in our catalog under these names: 2-Amino-5-chloro-3-methylpyridine hemihydrate, 97%, 5-Chloro-3-methylpyridin-2-amine hemihydrate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Bis(5-chloro-3-methylpyridin-2-amine);hydrate (CAS 1173019-45-8) is a chemical compound with the molecular formula C12H16Cl2N4O and a molecular weight of 303.18 g/mol. IUPAC name: bis(5-chloro-3-methylpyridin-2-amine);hydrate. InChIKey: XUNMRTSHBBFPTI-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N4O |
|---|---|
| Molecular weight | 303.18 g/mol |
| IUPAC name | bis(5-chloro-3-methylpyridin-2-amine);hydrate |
| InChIKey | XUNMRTSHBBFPTI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1N)Cl.CC1=CC(=CN=C1N)Cl.O |
Computed by PubChem (NCBI)