Products 1193389-12-6
CAS 1193389-12-6 is the registry number for N-(4-Amino-2-methylphenyl)-2-(1H-pyrazol-1-yl)acetamide dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-(4-amino-2-methylphenyl)-2-pyrazol-1-ylacetamide;dihydrochloride (CAS 1193389-12-6) is a chemical compound with the molecular formula C12H16Cl2N4O and a molecular weight of 303.18 g/mol. IUPAC name: N-(4-amino-2-methylphenyl)-2-pyrazol-1-ylacetamide;dihydrochloride. InChIKey: SZXWSRBZMQTHDF-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N4O |
|---|---|
| Molecular weight | 303.18 g/mol |
| IUPAC name | N-(4-amino-2-methylphenyl)-2-pyrazol-1-ylacetamide;dihydrochloride |
| InChIKey | SZXWSRBZMQTHDF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)NC(=O)CN2C=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)