CAS 2137135-74-9 is the registry number for (3R,5S)-5-(5-Phenyl-1H-1,2,4-triazol-3-yl)pyrrolidin-3-ol dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3R,5S)-5-(3-phenyl-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol;dihydrochloride (CAS 2137135-74-9) is a chemical compound with the molecular formula C12H16Cl2N4O and a molecular weight of 303.18 g/mol. IUPAC name: (3R,5S)-5-(3-phenyl-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol;dihydrochloride. InChIKey: MZUDNKFYUVOPTQ-NKRBYZSKSA-N.
| Molecular formula | C12H16Cl2N4O |
|---|---|
| Molecular weight | 303.18 g/mol |
| IUPAC name | (3R,5S)-5-(3-phenyl-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol;dihydrochloride |
| InChIKey | MZUDNKFYUVOPTQ-NKRBYZSKSA-N |
| SMILES | C1[C@H](CN[C@@H]1C2=NC(=NN2)C3=CC=CC=C3)O.Cl.Cl |
Computed by PubChem (NCBI)