CAS 1173020-03-5 appears in our catalog under these names: Metronidazole-13C2,15N2, Metronidazole 13C2,15N2 100 µg/mL in Acetonitrile, Metronidazole–13C2,15N2, METRONIDAZOLE-13C2,15N2 VETRANAL., Metronidazole-13C2,15N2, 99.30%. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 1ml, 1mg, 1 mg, 1x1ml, 1x10mg.
2-(2-(113C)methyl-5-nitro(213C,1,3-15N2)imidazol-1-yl)ethanol (CAS 1173020-03-5) is a chemical compound with the molecular formula C6H9N3O3 and a molecular weight of 175.13 g/mol. IUPAC name: 2-(2-(113C)methyl-5-nitro(213C,1,3-15N2)imidazol-1-yl)ethanol. InChIKey: VAOCPAMSLUNLGC-PNSZSYODSA-N.
| Molecular formula | C6H9N3O3 |
|---|---|
| Molecular weight | 175.13 g/mol |
| IUPAC name | 2-(2-(113C)methyl-5-nitro(213C,1,3-15N2)imidazol-1-yl)ethanol |
| InChIKey | VAOCPAMSLUNLGC-PNSZSYODSA-N |
| SMILES | [13CH3][13C]1=[15N]C=C([15N]1CCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)