CAS 827-16-7 appears in our catalog under these names: Trimethyl-1,3,5-triazinane-2,4,6-trione, 95%, Trimethyl-1,3,5-triazinane-2,4,6-trione, Trimethyl-1,3,5-triazinane-2,4,6-trione 95%, 1,3,5-Trimethyl-1,3,5-triazine-2,4,6(1H,3H,5H)-trione, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
1,3,5-trimethyl-1,3,5-triazinane-2,4,6-trione (CAS 827-16-7) is a chemical compound with the molecular formula C6H9N3O3 and a molecular weight of 171.15 g/mol. IUPAC name: 1,3,5-trimethyl-1,3,5-triazinane-2,4,6-trione. InChIKey: AHWDQDMGFXRVFB-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O3 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | 1,3,5-trimethyl-1,3,5-triazinane-2,4,6-trione |
| InChIKey | AHWDQDMGFXRVFB-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C(=O)N(C1=O)C)C |
Computed by PubChem (NCBI)