CAS 705-19-1 appears in our catalog under these names: 2-(2-Methyl-4-nitro-1h-imidazol-1-yl)ethanol, 95%, Metronidazole Impurity E, Metronidazole EP Impurity E, Isometronidazole, >95% (HPLC), 2-(2-Methyl-4-nitro-1H-imidazol-1-yl)ethanol. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, LoGiCal. Available pack sizes: 5g, 250mg, 1g, on request, 100mg, 25mg, 10mg, 50mg.
2-(2-methyl-4-nitroimidazol-1-yl)ethanol (CAS 705-19-1) is a chemical compound with the molecular formula C6H9N3O3 and a molecular weight of 171.15 g/mol. IUPAC name: 2-(2-methyl-4-nitroimidazol-1-yl)ethanol. InChIKey: RSXWJXPKLRYMHW-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O3 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | 2-(2-methyl-4-nitroimidazol-1-yl)ethanol |
| InChIKey | RSXWJXPKLRYMHW-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CN1CCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)