CAS 1173020-24-0 appears in our catalog under these names: 4-tert-Octylphenol-13C6, >95% (HPLC), 4-tert-Octylphenol 13C6 (phenyl 13C6), 4-tert-Octylphenol 13C6 100 µg/mL in Isooctane, 4-TERT-OCTYLPHENOL-RING-13C6 SOLUTION, 4-tert-Octylphenol-13C6. Offered by: TRC, Dr. Ehrenstorfer, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 1mg, 1ml, 1 mg.
4-(2,4,4-trimethylpentan-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol (CAS 1173020-24-0) is a chemical compound with the molecular formula C14H22O and a molecular weight of 212.28 g/mol. IUPAC name: 4-(2,4,4-trimethylpentan-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol. InChIKey: ISAVYTVYFVQUDY-UJYFPCGESA-N.
| Molecular formula | C14H22O |
|---|---|
| Molecular weight | 212.28 g/mol |
| IUPAC name | 4-(2,4,4-trimethylpentan-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol |
| InChIKey | ISAVYTVYFVQUDY-UJYFPCGESA-N |
| SMILES | CC(C)(C)CC(C)(C)[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)O |
Computed by PubChem (NCBI)