Products 1173021-73-2
CAS 1173021-73-2 appears in our catalog under these names: Salbutamol-d9, Rac Albuterol-d9, >95% (HPLC), (±)-Albuterol-d9 (tert-butyl-d9), 98 atom % D, min 98% Chemical Purity, Salbutamol–d9, Salbutamol-d9, 98.42%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 0,01g, 0,005g, 1mg, 500μg, 1 mg.
4-[2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol (CAS 1173021-73-2) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 248.37 g/mol. IUPAC name: 4-[2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol. InChIKey: NDAUXUAQIAJITI-GQALSZNTSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 248.37 g/mol |
| IUPAC name | 4-[2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
| InChIKey | NDAUXUAQIAJITI-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])NCC(C1=CC(=C(C=C1)O)CO)O |
Computed by PubChem (NCBI)