CAS 2517375-34-5 is the registry number for Salbutamol-d4. Offered by: MedChemExpress. Available pack sizes: 1 mg, 10 mg.
4-[2-(tert-butylamino)-1,2-dideuterio-1-hydroxyethyl]-2-[dideuterio(hydroxy)methyl]phenol (CAS 2517375-34-5) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 243.33 g/mol. IUPAC name: 4-[2-(tert-butylamino)-1,2-dideuterio-1-hydroxyethyl]-2-[dideuterio(hydroxy)methyl]phenol. InChIKey: NDAUXUAQIAJITI-HDBYNVFCSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 243.33 g/mol |
| IUPAC name | 4-[2-(tert-butylamino)-1,2-dideuterio-1-hydroxyethyl]-2-[dideuterio(hydroxy)methyl]phenol |
| InChIKey | NDAUXUAQIAJITI-HDBYNVFCSA-N |
| SMILES | [2H]C(C([2H])(C1=CC(=C(C=C1)O)C([2H])([2H])O)O)NC(C)(C)C |
Computed by PubChem (NCBI)