Products 1219798-60-3
CAS 1219798-60-3 appears in our catalog under these names: (±)-Albuterol-d3 (3-hydroxymethyl-d2, Alpha-d1), >95% (HPLC), (±)-Albuterol-d3 (3-hydroxymethyl-d2, alpha-d1), 98 atom % D, min 98% Chemical Purity, Salbutamol D3 (3-hydroxymethyl-D2,alpha D1) 100 μg/mL in Acetonitrile, Salbutamol-d3, Salbutamol-d3, 98.68%. Offered by: TRC, CDN, Dr. Ehrenstorfer, TargetMol, MedChemExpress. Available pack sizes: 10mg, 5mg, 0,01g, 0,005g, 1ml, 1mg, 1 mg, 10 mg.
4-[2-(tert-butylamino)-1-deuterio-1-hydroxyethyl]-2-[dideuterio(hydroxy)methyl]phenol (CAS 1219798-60-3) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 242.33 g/mol. IUPAC name: 4-[2-(tert-butylamino)-1-deuterio-1-hydroxyethyl]-2-[dideuterio(hydroxy)methyl]phenol. InChIKey: NDAUXUAQIAJITI-STOMFCJLSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 242.33 g/mol |
| IUPAC name | 4-[2-(tert-butylamino)-1-deuterio-1-hydroxyethyl]-2-[dideuterio(hydroxy)methyl]phenol |
| InChIKey | NDAUXUAQIAJITI-STOMFCJLSA-N |
| SMILES | [2H]C([2H])(C1=C(C=CC(=C1)C([2H])(CNC(C)(C)C)O)O)O |
Computed by PubChem (NCBI)