CAS 1173022-19-9 appears in our catalog under these names: 2-Methylimidazole-d6, >95% (HPLC), 2-Methylimidazole-d6, 98 atom % D, min 98% Chemical Purity, 2-Methylimidazole-d6, 0.9999%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g, 100 mg, 50 mg.
1,4,5-trideuterio-2-(trideuteriomethyl)imidazole (CAS 1173022-19-9) is a chemical compound with the molecular formula C4H6N2 and a molecular weight of 88.14 g/mol. IUPAC name: 1,4,5-trideuterio-2-(trideuteriomethyl)imidazole. InChIKey: LXBGSDVWAMZHDD-RSRPWSGMSA-N.
| Molecular formula | C4H6N2 |
|---|---|
| Molecular weight | 88.14 g/mol |
| IUPAC name | 1,4,5-trideuterio-2-(trideuteriomethyl)imidazole |
| InChIKey | LXBGSDVWAMZHDD-RSRPWSGMSA-N |
| SMILES | [2H]C1=C(N(C(=N1)C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)