CAS 697806-98-7 is the registry number for 2-Methylimidazole-d5 (Major), >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
4,5-dideuterio-2-(trideuteriomethyl)-1H-imidazole (CAS 697806-98-7) is a chemical compound with the molecular formula C4H6N2 and a molecular weight of 87.13 g/mol. IUPAC name: 4,5-dideuterio-2-(trideuteriomethyl)-1H-imidazole. InChIKey: LXBGSDVWAMZHDD-RHIBPKLGSA-N.
| Molecular formula | C4H6N2 |
|---|---|
| Molecular weight | 87.13 g/mol |
| IUPAC name | 4,5-dideuterio-2-(trideuteriomethyl)-1H-imidazole |
| InChIKey | LXBGSDVWAMZHDD-RHIBPKLGSA-N |
| SMILES | [2H]C1=C(N=C(N1)C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)