CAS 83413-07-4 appears in our catalog under these names: 2-Methylimidazole-d3 (~90%), >95% (HPLC), 2–(methyl–d3)–1H–imidazole. Offered by: TRC, GLPBio. Available pack sizes: 10mg, 5mg, 20mg.
2-(trideuteriomethyl)-1H-imidazole (CAS 83413-07-4) is a chemical compound with the molecular formula C4H6N2 and a molecular weight of 85.12 g/mol. IUPAC name: 2-(trideuteriomethyl)-1H-imidazole. InChIKey: LXBGSDVWAMZHDD-FIBGUPNXSA-N.
| Molecular formula | C4H6N2 |
|---|---|
| Molecular weight | 85.12 g/mol |
| IUPAC name | 2-(trideuteriomethyl)-1H-imidazole |
| InChIKey | LXBGSDVWAMZHDD-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC=CN1 |
Computed by PubChem (NCBI)