CAS 1173022-55-3 appears in our catalog under these names: 1,3,7-Trimethyluric acid-2,4,5,6-13C4-1,3,9-15N3, 98% 98%atom%13C,98%atom%15N, 1,3,7-Trimethyluric acid-2,4,5,6-13C4-1,3,9-15N3. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5mg, 25mg, 10mg, 50mg.
1,3,7-trimethyl-9H-purine-2,6,8-trione (CAS 1173022-55-3) is a chemical compound with the molecular formula C8H10N4O3 and a molecular weight of 217.14 g/mol. IUPAC name: 1,3,7-trimethyl-9H-purine-2,6,8-trione. InChIKey: BYXCFUMGEBZDDI-TWHZHSGKSA-N.
| Molecular formula | C8H10N4O3 |
|---|---|
| Molecular weight | 217.14 g/mol |
| IUPAC name | 1,3,7-trimethyl-9H-purine-2,6,8-trione |
| InChIKey | BYXCFUMGEBZDDI-TWHZHSGKSA-N |
| SMILES | CN1C(=O)[15NH][13C]2=[13C]1[13C](=O)[15N]([13C](=O)[15N]2C)C |
Computed by PubChem (NCBI)