CAS 1215205-33-6 is the registry number for N-(4-Methyl-3-nitropyridin-2-yl)acetohydrazide, 98%. Offered by: Combi-blocks. Available pack sizes: 100mg.
N-(4-methyl-3-nitro-2-pyridinyl)acetohydrazide (CAS 1215205-33-6) is a chemical compound with the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. IUPAC name: N-(4-methyl-3-nitro-2-pyridinyl)acetohydrazide. InChIKey: XLNPNHWSJMSOMA-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O3 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | N-(4-methyl-3-nitro-2-pyridinyl)acetohydrazide |
| InChIKey | XLNPNHWSJMSOMA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1)N(C(=O)C)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)