CAS 56119-16-5 is the registry number for Liberine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
2-methoxy-1,9-dimethyl-7H-purine-6,8-dione (CAS 56119-16-5) is a chemical compound with the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. IUPAC name: 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione. InChIKey: IDVFNSHOEYLXJD-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O3 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione |
| InChIKey | IDVFNSHOEYLXJD-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C(=N2)OC)C)NC1=O |
Computed by PubChem (NCBI)